C39H47N3O5S — CID 145123365
1,3-benzothiazol-2-amine;[2-methanimidoyl-4-(4-propylcyclohexyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 145123365) has the molecular formula C39H47N3O5S and a molecular weight of 669.89 g/mol. Its IUPAC name is 1,3-benzothiazol-2-amine;[2-methanimidoyl-4-(4-propylcyclohexyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | 1,3-benzothiazol-2-amine;[2-methanimidoyl-4-(4-propylcyclohexyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 145123365 |
| Molecular Formula | C39H47N3O5S |
| Molecular Weight | 669.89 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | 1,3-benzothiazol-2-amine;[2-methanimidoyl-4-(4-propylcyclohexyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | Nc1nc2ccccc2s1.[H]/N=C/c1cc(C2CCC(CCC)CC2)ccc1OC(=O)c1ccc(OCCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C32H41NO5.C7H6N2S/c1-3-9-24-10-12-25(13-11-24)27-16-19-30(28(22-27)23-33)38-32(35)26-14-17-29(18-15-26)36-20-7-5-6-8-21-37-31(34)4-2;8-7-9-5-3-1-2-4-6(5)10-7/h4,14-19,22-25,33H,2-3,5-13,20-21H2,1H3;1-4H,(H2,8,9)/b33-23+; |
| InChIKey | RWNDIJMAGZNWGV-QVXZZZNXSA-N |
| XLogP | 9.52 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.89 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|