C43H49N3O8S — CID 122417091
[2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylcyclohexyl)phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate (PubChem CID 122417091) has the molecular formula C43H49N3O8S and a molecular weight of 767.94 g/mol. Its IUPAC name is [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylcyclohexyl)phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate.
| Compound Name | [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylcyclohexyl)phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate |
|---|---|
| PubChem CID | 122417091 |
| Molecular Formula | C43H49N3O8S |
| Molecular Weight | 767.94 g/mol |
| Exact Mass | 767.32 |
| IUPAC Name | [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylcyclohexyl)phenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCCCCOCC(COc1ccc(C(=O)Oc2ccc(C3CCC(CCC)CC3)cc2/C=N/Nc2nc3ccccc3s2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C43H49N3O8S/c1-4-11-30-14-16-31(17-15-30)33-20-23-38(34(26-33)27-44-46-43-45-37-12-7-8-13-39(37)55-43)54-42(49)32-18-21-35(22-19-32)52-29-36(53-41(48)6-3)28-50-24-9-10-25-51-40(47)5-2/h5-8,12-13,18-23,26-27,30-31,36H,2-4,9-11,14-17,24-25,28-29H2,1H3,(H,45,46)/b44-27+ |
| InChIKey | LCNVGGRSUPUHQO-ZSTTVQMRSA-N |
| XLogP | 9.04 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.94 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|