C41H35N3O11S — CID 134312755
2-[4-(4-acetyloxybenzoyl)oxy-3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl]ethyl 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate (PubChem CID 134312755) has the molecular formula C41H35N3O11S and a molecular weight of 777.81 g/mol. Its IUPAC name is 2-[4-(4-acetyloxybenzoyl)oxy-3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl]ethyl 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate.
| Compound Name | 2-[4-(4-acetyloxybenzoyl)oxy-3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl]ethyl 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 134312755 |
| Molecular Formula | C41H35N3O11S |
| Molecular Weight | 777.81 g/mol |
| Exact Mass | 777.20 |
| IUPAC Name | 2-[4-(4-acetyloxybenzoyl)oxy-3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]phenyl]ethyl 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCC(COc1ccc(C(=O)OCCc2ccc(OC(=O)c3ccc(OC(C)=O)cc3)c(/C=N/Nc3nc4ccccc4s3)c2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C41H35N3O11S/c1-4-37(46)52-25-33(54-38(47)5-2)24-51-31-15-11-28(12-16-31)39(48)50-21-20-27-10-19-35(55-40(49)29-13-17-32(18-14-29)53-26(3)45)30(22-27)23-42-44-41-43-34-8-6-7-9-36(34)56-41/h4-19,22-23,33H,1-2,20-21,24-25H2,3H3,(H,43,44)/b42-23+ |
| InChIKey | GZJQXMAOHGAOTG-SNDAAJCPSA-N |
| XLogP | 6.49 |
| TPSA | 178.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|