C39H35N3O7S — CID 122418999
[2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate (PubChem CID 122418999) has the molecular formula C39H35N3O7S and a molecular weight of 689.79 g/mol. Its IUPAC name is [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 122418999 |
| Molecular Formula | C39H35N3O7S |
| Molecular Weight | 689.79 g/mol |
| Exact Mass | 689.22 |
| IUPAC Name | [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCC(COc1ccc(C(=O)Oc2ccc(-c3ccc(CCC)cc3)cc2/C=N/Nc2nc3ccccc3s2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C39H35N3O7S/c1-4-9-26-12-14-27(15-13-26)29-18-21-34(30(22-29)23-40-42-39-41-33-10-7-8-11-35(33)50-39)49-38(45)28-16-19-31(20-17-28)46-24-32(48-37(44)6-3)25-47-36(43)5-2/h5-8,10-23,32H,2-4,9,24-25H2,1H3,(H,41,42)/b40-23+ |
| InChIKey | CXEYRJPAGPIYHG-ZXTCRCEHSA-N |
| XLogP | 7.79 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.79 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|