C40H39N3O7S — CID 129174309
[2-[(E)-[(7a-methyl-3aH-1,3-benzothiazol-2-yl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate (PubChem CID 129174309) has the molecular formula C40H39N3O7S and a molecular weight of 705.83 g/mol. Its IUPAC name is [2-[(E)-[(7a-methyl-3aH-1,3-benzothiazol-2-yl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate.
| Compound Name | [2-[(E)-[(7a-methyl-3aH-1,3-benzothiazol-2-yl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate |
|---|---|
| PubChem CID | 129174309 |
| Molecular Formula | C40H39N3O7S |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | [2-[(E)-[(7a-methyl-3aH-1,3-benzothiazol-2-yl)hydrazinylidene]methyl]-4-(4-propylphenyl)phenyl] 4-[2,3-di(prop-2-enoyloxy)propoxy]benzoate |
| SMILES | C=CC(=O)OCC(COc1ccc(C(=O)Oc2ccc(-c3ccc(CCC)cc3)cc2/C=N/NC2=NC3C=CC=CC3(C)S2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C40H39N3O7S/c1-5-10-27-12-14-28(15-13-27)30-18-21-34(31(23-30)24-41-43-39-42-35-11-8-9-22-40(35,4)51-39)50-38(46)29-16-19-32(20-17-29)47-25-33(49-37(45)7-3)26-48-36(44)6-2/h6-9,11-24,33,35H,2-3,5,10,25-26H2,1,4H3,(H,42,43)/b41-24+ |
| InChIKey | YHDUOOBLYUFOSO-JBZNKQRISA-N |
| XLogP | 7.01 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|