C39H31N3O10S — CID 166738258
2-[3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-[hydroxy-(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl 3,4-di(prop-2-enoyloxy)benzoate (PubChem CID 166738258) has the molecular formula C39H31N3O10S and a molecular weight of 733.75 g/mol. Its IUPAC name is 2-[3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-[hydroxy-(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl 3,4-di(prop-2-enoyloxy)benzoate.
| Compound Name | 2-[3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-[hydroxy-(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl 3,4-di(prop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 166738258 |
| Molecular Formula | C39H31N3O10S |
| Molecular Weight | 733.75 g/mol |
| Exact Mass | 733.17 |
| IUPAC Name | 2-[3-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-[hydroxy-(4-prop-2-enoyloxyphenyl)methoxy]phenyl]ethyl 3,4-di(prop-2-enoyloxy)benzoate |
| SMILES | C=CC(=O)Oc1ccc(C(O)Oc2ccc(CCOC(=O)c3ccc(OC(=O)C=C)c(OC(=O)C=C)c3)cc2/C=N/Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C39H31N3O10S/c1-4-34(43)49-28-15-12-25(13-16-28)38(47)52-30-17-11-24(21-27(30)23-40-42-39-41-29-9-7-8-10-33(29)53-39)19-20-48-37(46)26-14-18-31(50-35(44)5-2)32(22-26)51-36(45)6-3/h4-18,21-23,38,47H,1-3,19-20H2,(H,41,42)/b40-23+ |
| InChIKey | LGRAAXATOATIPK-ZXTCRCEHSA-N |
| XLogP | 6.49 |
| TPSA | 171.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.75 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|