C41H43N3O8S — CID 140915674
[2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-butoxycyclohexa-1,3-diene-1-carbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 140915674) has the molecular formula C41H43N3O8S and a molecular weight of 737.88 g/mol. Its IUPAC name is [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-butoxycyclohexa-1,3-diene-1-carbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-butoxycyclohexa-1,3-diene-1-carbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 140915674 |
| Molecular Formula | C41H43N3O8S |
| Molecular Weight | 737.88 g/mol |
| Exact Mass | 737.28 |
| IUPAC Name | [2-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-(4-butoxycyclohexa-1,3-diene-1-carbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3=CC=C(OCCCC)CC3)cc2/C=N/Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C41H43N3O8S/c1-3-5-24-48-32-18-14-29(15-19-32)39(46)51-34-22-23-36(31(27-34)28-42-44-41-43-35-12-8-9-13-37(35)53-41)52-40(47)30-16-20-33(21-17-30)49-25-10-6-7-11-26-50-38(45)4-2/h4,8-9,12-14,16-18,20-23,27-28H,2-3,5-7,10-11,15,19,24-26H2,1H3,(H,43,44)/b42-28+ |
| InChIKey | BAFHZYDIZSXRAV-VSMKPTLZSA-N |
| XLogP | 8.96 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.88 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|