C40H40N4O5S — CID 134235678
[5-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 134235678) has the molecular formula C40H40N4O5S and a molecular weight of 688.85 g/mol. Its IUPAC name is [5-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [5-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 134235678 |
| Molecular Formula | C40H40N4O5S |
| Molecular Weight | 688.85 g/mol |
| Exact Mass | 688.27 |
| IUPAC Name | [5-[(E)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-methanimidoyl-4-(4-propylphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | [H]/N=C/c1cc(-c2ccc(CCC)cc2)c(/C=N/Nc2nc3ccccc3s2)cc1OC(=O)c1ccc(OCCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C40H40N4O5S/c1-3-11-28-14-16-29(17-15-28)34-24-31(26-41)36(25-32(34)27-42-44-40-43-35-12-7-8-13-37(35)50-40)49-39(46)30-18-20-33(21-19-30)47-22-9-5-6-10-23-48-38(45)4-2/h4,7-8,12-21,24-27,41H,2-3,5-6,9-11,22-23H2,1H3,(H,43,44)/b41-26+,42-27+ |
| InChIKey | JUXFCHUAESSDRJ-DDTNVXSTSA-N |
| XLogP | 9.25 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.85 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|