C49H53N3O5S — CID 157491703
1,3-benzothiazol-2-amine;[2-methanimidoyl-4-[2-[4-(4-pentylphenyl)phenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 157491703) has the molecular formula C49H53N3O5S and a molecular weight of 796.05 g/mol. Its IUPAC name is 1,3-benzothiazol-2-amine;[2-methanimidoyl-4-[2-[4-(4-pentylphenyl)phenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | 1,3-benzothiazol-2-amine;[2-methanimidoyl-4-[2-[4-(4-pentylphenyl)phenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 157491703 |
| Molecular Formula | C49H53N3O5S |
| Molecular Weight | 796.05 g/mol |
| Exact Mass | 795.37 |
| IUPAC Name | 1,3-benzothiazol-2-amine;[2-methanimidoyl-4-[2-[4-(4-pentylphenyl)phenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | Nc1nc2ccccc2s1.[H]/N=C/c1cc(CCc2ccc(-c3ccc(CCCCC)cc3)cc2)ccc1OC(=O)c1ccc(OCCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C42H47NO5.C7H6N2S/c1-3-5-8-11-32-14-19-35(20-15-32)36-21-16-33(17-22-36)12-13-34-18-27-40(38(30-34)31-43)48-42(45)37-23-25-39(26-24-37)46-28-9-6-7-10-29-47-41(44)4-2;8-7-9-5-3-1-2-4-6(5)10-7/h4,14-27,30-31,43H,2-3,5-13,28-29H2,1H3;1-4H,(H2,8,9)/b43-31+; |
| InChIKey | BXIUVAFAUSDEPN-VRJFINBMSA-N |
| XLogP | 11.64 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.05 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|