C51H53NO9 — CID 90704922
[4-(4-methanimidoylphenyl)phenyl] prop-2-enoate;[4-(4-octoxybenzoyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 90704922) has the molecular formula C51H53NO9 and a molecular weight of 823.98 g/mol. Its IUPAC name is [4-(4-methanimidoylphenyl)phenyl] prop-2-enoate;[4-(4-octoxybenzoyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-(4-methanimidoylphenyl)phenyl] prop-2-enoate;[4-(4-octoxybenzoyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 90704922 |
| Molecular Formula | C51H53NO9 |
| Molecular Weight | 823.98 g/mol |
| Exact Mass | 823.37 |
| IUPAC Name | [4-(4-methanimidoylphenyl)phenyl] prop-2-enoate;[4-(4-octoxybenzoyl)phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)c3ccc(OCCCCCCCC)cc3)cc2)cc1.[H]/N=C/c1ccc(-c2ccc(OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C35H40O7.C16H13NO2/c1-3-5-6-7-8-9-24-39-30-18-12-27(13-19-30)34(37)28-14-22-32(23-15-28)42-35(38)29-16-20-31(21-17-29)40-25-10-11-26-41-33(36)4-2;1-2-16(18)19-15-9-7-14(8-10-15)13-5-3-12(11-17)4-6-13/h4,12-23H,2-3,5-11,24-26H2,1H3;2-11,17H,1H2/b;17-11+ |
| InChIKey | DCNHGHWTJRSJDD-GNKLODFQSA-N |
| XLogP | 11.21 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.98 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|