C30H31NO6 — CID 145123415
[3-methanimidoyl-4-(4-methoxyphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 145123415) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is [3-methanimidoyl-4-(4-methoxyphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [3-methanimidoyl-4-(4-methoxyphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 145123415 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | [3-methanimidoyl-4-(4-methoxyphenyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | [H]/N=C/c1cc(OC(=O)c2ccc(OCCCCCCOC(=O)C=C)cc2)ccc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H31NO6/c1-3-29(32)36-19-7-5-4-6-18-35-26-14-10-23(11-15-26)30(33)37-27-16-17-28(24(20-27)21-31)22-8-12-25(34-2)13-9-22/h3,8-17,20-21,31H,1,4-7,18-19H2,2H3/b31-21+ |
| InChIKey | XOGMPTMJJGOFMV-NJZRLIGZSA-N |
| XLogP | 6.25 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|