C33H31FN2O7 — CID 134235672
[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2,5-dimethanimidoylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 134235672) has the molecular formula C33H31FN2O7 and a molecular weight of 586.62 g/mol. Its IUPAC name is [4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2,5-dimethanimidoylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2,5-dimethanimidoylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 134235672 |
| Molecular Formula | C33H31FN2O7 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | [4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2,5-dimethanimidoylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | [H]/N=C/c1cc(-c2ccc(OC(=O)C(=C)F)cc2)c(/C=N/[H])cc1OC(=O)c1ccc(OCCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C33H31FN2O7/c1-3-31(37)41-17-7-5-4-6-16-40-27-12-10-24(11-13-27)33(39)43-30-19-25(20-35)29(18-26(30)21-36)23-8-14-28(15-9-23)42-32(38)22(2)34/h3,8-15,18-21,35-36H,1-2,4-7,16-17H2/b35-20+,36-21+ |
| InChIKey | BVQUSHKVKMHWSX-CJVLSJCWSA-N |
| XLogP | 6.63 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|