C45H51NO8 — CID 129146236
6-[4-[[4-[2-methanimidoyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl]phenoxy]methyl]phenoxy]hexyl prop-2-enoate (PubChem CID 129146236) has the molecular formula C45H51NO8 and a molecular weight of 733.90 g/mol. Its IUPAC name is 6-[4-[[4-[2-methanimidoyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl]phenoxy]methyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[[4-[2-methanimidoyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl]phenoxy]methyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 129146236 |
| Molecular Formula | C45H51NO8 |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.36 |
| IUPAC Name | 6-[4-[[4-[2-methanimidoyl-4-[[4-(6-prop-2-enoyloxyhexoxy)phenyl]methoxy]phenyl]phenoxy]methyl]phenoxy]hexyl prop-2-enoate |
| SMILES | [H]/N=C/c1cc(OCc2ccc(OCCCCCCOC(=O)C=C)cc2)ccc1-c1ccc(OCc2ccc(OCCCCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C45H51NO8/c1-3-44(47)51-29-11-7-5-9-27-49-39-19-13-35(14-20-39)33-53-41-23-17-37(18-24-41)43-26-25-42(31-38(43)32-46)54-34-36-15-21-40(22-16-36)50-28-10-6-8-12-30-52-45(48)4-2/h3-4,13-26,31-32,46H,1-2,5-12,27-30,33-34H2/b46-32+ |
| InChIKey | KHAUCCHPTWORHY-LGDHCNBZSA-N |
| XLogP | 9.85 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|