C41H47NO10 — CID 130417209
2-[3-methanimidoyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]ethyl 4-(5-prop-2-enoyloxypentoxy)benzoate (PubChem CID 130417209) has the molecular formula C41H47NO10 and a molecular weight of 713.82 g/mol. Its IUPAC name is 2-[3-methanimidoyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]ethyl 4-(5-prop-2-enoyloxypentoxy)benzoate.
| Compound Name | 2-[3-methanimidoyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]ethyl 4-(5-prop-2-enoyloxypentoxy)benzoate |
|---|---|
| PubChem CID | 130417209 |
| Molecular Formula | C41H47NO10 |
| Molecular Weight | 713.82 g/mol |
| Exact Mass | 713.32 |
| IUPAC Name | 2-[3-methanimidoyl-4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]ethyl 4-(5-prop-2-enoyloxypentoxy)benzoate |
| SMILES | [H]/N=C/c1cc(CCOC(=O)c2ccc(OCCCCCOC(=O)C=C)cc2)ccc1CCOC(=O)c1ccc(OCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C41H47NO10/c1-3-38(43)49-25-9-5-7-23-47-36-17-13-33(14-18-36)40(45)51-27-21-31-11-12-32(35(29-31)30-42)22-28-52-41(46)34-15-19-37(20-16-34)48-24-8-6-10-26-50-39(44)4-2/h3-4,11-20,29-30,42H,1-2,5-10,21-28H2/b42-30+ |
| InChIKey | WYMVBPUCNZUYRH-OJZPPULMSA-N |
| XLogP | 7.04 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.82 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|