C38H42O10 — CID 175090806
4-(5-prop-2-enoyloxypentoxy)-2-[4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]benzoic acid (PubChem CID 175090806) has the molecular formula C38H42O10 and a molecular weight of 658.74 g/mol. Its IUPAC name is 4-(5-prop-2-enoyloxypentoxy)-2-[4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]benzoic acid.
| Compound Name | 4-(5-prop-2-enoyloxypentoxy)-2-[4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 175090806 |
| Molecular Formula | C38H42O10 |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | 4-(5-prop-2-enoyloxypentoxy)-2-[4-[2-[4-(5-prop-2-enoyloxypentoxy)benzoyl]oxyethyl]phenyl]benzoic acid |
| SMILES | C=CC(=O)OCCCCCOc1ccc(C(=O)OCCc2ccc(-c3cc(OCCCCCOC(=O)C=C)ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C38H42O10/c1-3-35(39)46-24-9-5-7-22-44-31-17-15-30(16-18-31)38(43)48-26-21-28-11-13-29(14-12-28)34-27-32(19-20-33(34)37(41)42)45-23-8-6-10-25-47-36(40)4-2/h3-4,11-20,27H,1-2,5-10,21-26H2,(H,41,42) |
| InChIKey | SKMXIDZEYAUOHQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|