C44H50O11S — CID 175126458
4-[8-(4-methylphenyl)sulfonyloxyoctoxy]-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoic acid (PubChem CID 175126458) has the molecular formula C44H50O11S and a molecular weight of 786.94 g/mol. Its IUPAC name is 4-[8-(4-methylphenyl)sulfonyloxyoctoxy]-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoic acid.
| Compound Name | 4-[8-(4-methylphenyl)sulfonyloxyoctoxy]-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 175126458 |
| Molecular Formula | C44H50O11S |
| Molecular Weight | 786.94 g/mol |
| Exact Mass | 786.31 |
| IUPAC Name | 4-[8-(4-methylphenyl)sulfonyloxyoctoxy]-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl]benzoic acid |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(-c3cc(OCCCCCCCCOS(=O)(=O)c4ccc(C)cc4)ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C44H50O11S/c1-3-42(45)53-30-12-9-8-11-28-51-36-20-18-35(19-21-36)44(48)55-37-22-16-34(17-23-37)41-32-38(24-27-40(41)43(46)47)52-29-10-6-4-5-7-13-31-54-56(49,50)39-25-14-33(2)15-26-39/h3,14-27,32H,1,4-13,28-31H2,2H3,(H,46,47) |
| InChIKey | XIOHHBMKVNSSJE-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.94 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|