C31H38O10 — CID 175449935
4-(6-prop-2-enoylperoxyhexoxy)-2-[4-(6-prop-2-enoylperoxyhexoxy)phenyl]benzoic acid (PubChem CID 175449935) has the molecular formula C31H38O10 and a molecular weight of 570.64 g/mol. Its IUPAC name is 4-(6-prop-2-enoylperoxyhexoxy)-2-[4-(6-prop-2-enoylperoxyhexoxy)phenyl]benzoic acid.
| Compound Name | 4-(6-prop-2-enoylperoxyhexoxy)-2-[4-(6-prop-2-enoylperoxyhexoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 175449935 |
| Molecular Formula | C31H38O10 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 4-(6-prop-2-enoylperoxyhexoxy)-2-[4-(6-prop-2-enoylperoxyhexoxy)phenyl]benzoic acid |
| SMILES | C=CC(=O)OOCCCCCCOc1ccc(-c2cc(OCCCCCCOOC(=O)C=C)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H38O10/c1-3-29(32)40-38-21-11-7-5-9-19-36-25-15-13-24(14-16-25)28-23-26(17-18-27(28)31(34)35)37-20-10-6-8-12-22-39-41-30(33)4-2/h3-4,13-18,23H,1-2,5-12,19-22H2,(H,34,35) |
| InChIKey | RUHHRPNMCNKAEE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|