C30H24O6 — CID 69100488
2-[6-(2-carboxy-5-prop-2-enoxyphenyl)naphthalen-2-yl]-4-prop-2-enoxybenzoic acid (PubChem CID 69100488) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-[6-(2-carboxy-5-prop-2-enoxyphenyl)naphthalen-2-yl]-4-prop-2-enoxybenzoic acid.
| Compound Name | 2-[6-(2-carboxy-5-prop-2-enoxyphenyl)naphthalen-2-yl]-4-prop-2-enoxybenzoic acid |
|---|---|
| PubChem CID | 69100488 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[6-(2-carboxy-5-prop-2-enoxyphenyl)naphthalen-2-yl]-4-prop-2-enoxybenzoic acid |
| SMILES | C=CCOc1ccc(C(=O)O)c(-c2ccc3cc(-c4cc(OCC=C)ccc4C(=O)O)ccc3c2)c1 |
| InChI | InChI=1S/C30H24O6/c1-3-13-35-23-9-11-25(29(31)32)27(17-23)21-7-5-20-16-22(8-6-19(20)15-21)28-18-24(36-14-4-2)10-12-26(28)30(33)34/h3-12,15-18H,1-2,13-14H2,(H,31,32)(H,33,34) |
| InChIKey | QLSJYLNOFDQMNB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|