C37H36O14 — CID 175736508
2-[4-[2-methoxycarbonyl-5-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid (PubChem CID 175736508) has the molecular formula C37H36O14 and a molecular weight of 704.68 g/mol. Its IUPAC name is 2-[4-[2-methoxycarbonyl-5-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid.
| Compound Name | 2-[4-[2-methoxycarbonyl-5-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid |
|---|---|
| PubChem CID | 175736508 |
| Molecular Formula | C37H36O14 |
| Molecular Weight | 704.68 g/mol |
| Exact Mass | 704.21 |
| IUPAC Name | 2-[4-[2-methoxycarbonyl-5-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)O)c(-c2ccc(-c3cc(OC(=O)OCCCCOC(=O)C=C)ccc3C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C37H36O14/c1-4-32(38)46-18-6-8-20-48-36(43)50-26-14-16-28(34(40)41)30(22-26)24-10-12-25(13-11-24)31-23-27(15-17-29(31)35(42)45-3)51-37(44)49-21-9-7-19-47-33(39)5-2/h4-5,10-17,22-23H,1-2,6-9,18-21H2,3H3,(H,40,41) |
| InChIKey | HZWZFMAVVMDTIY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|