C39H40O15 — CID 89253382
3-[4-[3-carboxy-2-methyl-6-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]-3-methoxyphenyl]-2-methyl-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid (PubChem CID 89253382) has the molecular formula C39H40O15 and a molecular weight of 748.73 g/mol. Its IUPAC name is 3-[4-[3-carboxy-2-methyl-6-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]-3-methoxyphenyl]-2-methyl-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid.
| Compound Name | 3-[4-[3-carboxy-2-methyl-6-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]-3-methoxyphenyl]-2-methyl-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid |
|---|---|
| PubChem CID | 89253382 |
| Molecular Formula | C39H40O15 |
| Molecular Weight | 748.73 g/mol |
| Exact Mass | 748.24 |
| IUPAC Name | 3-[4-[3-carboxy-2-methyl-6-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]-3-methoxyphenyl]-2-methyl-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)O)c(C)c1-c1ccc(-c2c(OC(=O)OCCCCOC(=O)C=C)ccc(C(=O)O)c2C)c(OC)c1 |
| InChI | InChI=1S/C39H40O15/c1-6-32(40)49-18-8-10-20-51-38(46)53-29-16-14-26(36(42)43)23(3)34(29)25-12-13-28(31(22-25)48-5)35-24(4)27(37(44)45)15-17-30(35)54-39(47)52-21-11-9-19-50-33(41)7-2/h6-7,12-17,22H,1-2,8-11,18-21H2,3-5H3,(H,42,43)(H,44,45) |
| InChIKey | UNLLVYBMFNCFLB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 207.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.73 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|