C36H38O10 — CID 135130105
4-[4-[2,5-dimethyl-4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenoxy]carbonyloxybutyl prop-2-enoate (PubChem CID 135130105) has the molecular formula C36H38O10 and a molecular weight of 630.69 g/mol. Its IUPAC name is 4-[4-[2,5-dimethyl-4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenoxy]carbonyloxybutyl prop-2-enoate.
| Compound Name | 4-[4-[2,5-dimethyl-4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenoxy]carbonyloxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 135130105 |
| Molecular Formula | C36H38O10 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 4-[4-[2,5-dimethyl-4-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]phenyl]phenoxy]carbonyloxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(-c2cc(C)c(-c3ccc(OC(=O)OCCCCOC(=O)C=C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C36H38O10/c1-5-33(37)41-19-7-9-21-43-35(39)45-29-15-11-27(12-16-29)31-23-26(4)32(24-25(31)3)28-13-17-30(18-14-28)46-36(40)44-22-10-8-20-42-34(38)6-2/h5-6,11-18,23-24H,1-2,7-10,19-22H2,3-4H3 |
| InChIKey | PYWSSLZPKCJEJH-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|