C36H38O11 — CID 67241258
2-[3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]-3-methyl-4-(4-prop-2-enoyloxybutoxy)benzoic acid (PubChem CID 67241258) has the molecular formula C36H38O11 and a molecular weight of 646.69 g/mol. Its IUPAC name is 2-[3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]-3-methyl-4-(4-prop-2-enoyloxybutoxy)benzoic acid.
| Compound Name | 2-[3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]-3-methyl-4-(4-prop-2-enoyloxybutoxy)benzoic acid |
|---|---|
| PubChem CID | 67241258 |
| Molecular Formula | C36H38O11 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 2-[3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]-3-methyl-4-(4-prop-2-enoyloxybutoxy)benzoic acid |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(-c3c(C(=O)O)ccc(OCCCCOC(=O)C=C)c3C)cc2OC)cc1 |
| InChI | InChI=1S/C36H38O11/c1-5-32(37)45-21-9-7-19-43-27-14-11-25(12-15-27)36(41)47-30-17-13-26(23-31(30)42-4)34-24(3)29(18-16-28(34)35(39)40)44-20-8-10-22-46-33(38)6-2/h5-6,11-18,23H,1-2,7-10,19-22H2,3-4H3,(H,39,40) |
| InChIKey | BETXESLEZIXLGZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|