C16H16O7 — CID 70465567
2-hydroxy-4-prop-2-enoyloxy-3-(3-prop-2-enoyloxypropyl)benzoic acid (PubChem CID 70465567) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-hydroxy-4-prop-2-enoyloxy-3-(3-prop-2-enoyloxypropyl)benzoic acid.
| Compound Name | 2-hydroxy-4-prop-2-enoyloxy-3-(3-prop-2-enoyloxypropyl)benzoic acid |
|---|---|
| PubChem CID | 70465567 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-hydroxy-4-prop-2-enoyloxy-3-(3-prop-2-enoyloxypropyl)benzoic acid |
| SMILES | C=CC(=O)OCCCc1c(OC(=O)C=C)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C16H16O7/c1-3-13(17)22-9-5-6-10-12(23-14(18)4-2)8-7-11(15(10)19)16(20)21/h3-4,7-8,19H,1-2,5-6,9H2,(H,20,21) |
| InChIKey | PLQAJZXFZSKFKU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|