C14H18O4 — CID 67718834
3-(3,4-dimethoxyphenyl)propyl prop-2-enoate (PubChem CID 67718834) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)propyl prop-2-enoate.
| Compound Name | 3-(3,4-dimethoxyphenyl)propyl prop-2-enoate |
|---|---|
| PubChem CID | 67718834 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H18O4/c1-4-14(15)18-9-5-6-11-7-8-12(16-2)13(10-11)17-3/h4,7-8,10H,1,5-6,9H2,2-3H3 |
| InChIKey | MQAPBWPSEPDFRG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|