C21H29NO3 — CID 88651362
13-(3,4-dimethoxyphenyl)trideca-5,7,9-trienamide (PubChem CID 88651362) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 13-(3,4-dimethoxyphenyl)trideca-5,7,9-trienamide.
| Compound Name | 13-(3,4-dimethoxyphenyl)trideca-5,7,9-trienamide |
|---|---|
| PubChem CID | 88651362 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 13-(3,4-dimethoxyphenyl)trideca-5,7,9-trienamide |
| SMILES | COc1ccc(CCCC=CC=CC=CCCCC(N)=O)cc1OC |
| InChI | InChI=1S/C21H29NO3/c1-24-19-16-15-18(17-20(19)25-2)13-11-9-7-5-3-4-6-8-10-12-14-21(22)23/h3-8,15-17H,9-14H2,1-2H3,(H2,22,23) |
| InChIKey | BPJFRPHXVLGEPP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|