C16H18O8 — CID 141296791
3-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid (PubChem CID 141296791) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is 3-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid.
| Compound Name | 3-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid |
|---|---|
| PubChem CID | 141296791 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)O)cc1OC |
| InChI | InChI=1S/C16H18O8/c1-3-14(17)22-8-4-5-9-23-16(20)24-12-7-6-11(15(18)19)10-13(12)21-2/h3,6-7,10H,1,4-5,8-9H2,2H3,(H,18,19) |
| InChIKey | QFEMWQWSJXNFBP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|