C34H48O11 — CID 90240498
3,4,5-tris(6-prop-2-enoyloxyhexoxy)benzoic acid (PubChem CID 90240498) has the molecular formula C34H48O11 and a molecular weight of 632.75 g/mol. Its IUPAC name is 3,4,5-tris(6-prop-2-enoyloxyhexoxy)benzoic acid.
| Compound Name | 3,4,5-tris(6-prop-2-enoyloxyhexoxy)benzoic acid |
|---|---|
| PubChem CID | 90240498 |
| Molecular Formula | C34H48O11 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | 3,4,5-tris(6-prop-2-enoyloxyhexoxy)benzoic acid |
| SMILES | C=CC(=O)OCCCCCCOc1cc(C(=O)O)cc(OCCCCCCOC(=O)C=C)c1OCCCCCCOC(=O)C=C |
| InChI | InChI=1S/C34H48O11/c1-4-30(35)42-21-15-9-7-13-19-40-28-25-27(34(38)39)26-29(41-20-14-8-10-16-22-43-31(36)5-2)33(28)45-24-18-12-11-17-23-44-32(37)6-3/h4-6,25-26H,1-3,7-24H2,(H,38,39) |
| InChIKey | CXQFGKVIHIKGHX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|