C11H16O4 — CID 166514951
4-(3-hydroperoxypropyl)-1,2-dimethoxybenzene (PubChem CID 166514951) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-(3-hydroperoxypropyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3-hydroperoxypropyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 166514951 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-(3-hydroperoxypropyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CCCOO)cc1OC |
| InChI | InChI=1S/C11H16O4/c1-13-10-6-5-9(4-3-7-15-12)8-11(10)14-2/h5-6,8,12H,3-4,7H2,1-2H3 |
| InChIKey | JHWAHNRSFHCSTN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|