C12H17IO2 — CID 86035361
4-(4-iodobutyl)-1,2-dimethoxybenzene (PubChem CID 86035361) has the molecular formula C12H17IO2 and a molecular weight of 320.17 g/mol. Its IUPAC name is 4-(4-iodobutyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(4-iodobutyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 86035361 |
| Molecular Formula | C12H17IO2 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-(4-iodobutyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CCCCI)cc1OC |
| InChI | InChI=1S/C12H17IO2/c1-14-11-7-6-10(5-3-4-8-13)9-12(11)15-2/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | PXLKVZCNIMOILU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|