C39H57NO6 — CID 57389908
5-(3,4-dimethoxyphenyl)-N,N-bis[5-(3,4-dimethoxyphenyl)pentyl]pentan-1-amine (PubChem CID 57389908) has the molecular formula C39H57NO6 and a molecular weight of 635.89 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N,N-bis[5-(3,4-dimethoxyphenyl)pentyl]pentan-1-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N,N-bis[5-(3,4-dimethoxyphenyl)pentyl]pentan-1-amine |
|---|---|
| PubChem CID | 57389908 |
| Molecular Formula | C39H57NO6 |
| Molecular Weight | 635.89 g/mol |
| Exact Mass | 635.42 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N,N-bis[5-(3,4-dimethoxyphenyl)pentyl]pentan-1-amine |
| SMILES | COc1ccc(CCCCCN(CCCCCc2ccc(OC)c(OC)c2)CCCCCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C39H57NO6/c1-41-34-22-19-31(28-37(34)44-4)16-10-7-13-25-40(26-14-8-11-17-32-20-23-35(42-2)38(29-32)45-5)27-15-9-12-18-33-21-24-36(43-3)39(30-33)46-6/h19-24,28-30H,7-18,25-27H2,1-6H3 |
| InChIKey | UQCWVBAXEXNZDU-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.89 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|