C13H20FNO — CID 155593714
4-(3-fluoro-4-methoxyphenyl)-N,N-dimethylbutan-1-amine (PubChem CID 155593714) has the molecular formula C13H20FNO and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyphenyl)-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(3-fluoro-4-methoxyphenyl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 155593714 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-(3-fluoro-4-methoxyphenyl)-N,N-dimethylbutan-1-amine |
| SMILES | COc1ccc(CCCCN(C)C)cc1F |
| InChI | InChI=1S/C13H20FNO/c1-15(2)9-5-4-6-11-7-8-13(16-3)12(14)10-11/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | HYDKGEBGWBJZMU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|