C11H17FN2O — CID 115195380
N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]ethane-1,2-diamine (PubChem CID 115195380) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115195380 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N'-[2-(3-fluoro-4-methoxyphenyl)ethyl]ethane-1,2-diamine |
| SMILES | COc1ccc(CCNCCN)cc1F |
| InChI | InChI=1S/C11H17FN2O/c1-15-11-3-2-9(8-10(11)12)4-6-14-7-5-13/h2-3,8,14H,4-7,13H2,1H3 |
| InChIKey | BPHLWHYHHXUUQT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|