C14H16FNOS — CID 60976262
N-[(3-fluoro-4-methoxyphenyl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 60976262) has the molecular formula C14H16FNOS and a molecular weight of 265.35 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 60976262 |
| Molecular Formula | C14H16FNOS |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | COc1ccc(CNCCc2ccsc2)cc1F |
| InChI | InChI=1S/C14H16FNOS/c1-17-14-3-2-12(8-13(14)15)9-16-6-4-11-5-7-18-10-11/h2-3,5,7-8,10,16H,4,6,9H2,1H3 |
| InChIKey | BKVQPDRPCNUQNO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|