C12H18FNOS — CID 115225090
3-[2-(3-fluoro-4-methoxyphenyl)ethylamino]propane-1-thiol (PubChem CID 115225090) has the molecular formula C12H18FNOS and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-[2-(3-fluoro-4-methoxyphenyl)ethylamino]propane-1-thiol.
| Compound Name | 3-[2-(3-fluoro-4-methoxyphenyl)ethylamino]propane-1-thiol |
|---|---|
| PubChem CID | 115225090 |
| Molecular Formula | C12H18FNOS |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-[2-(3-fluoro-4-methoxyphenyl)ethylamino]propane-1-thiol |
| SMILES | COc1ccc(CCNCCCS)cc1F |
| InChI | InChI=1S/C12H18FNOS/c1-15-12-4-3-10(9-11(12)13)5-7-14-6-2-8-16/h3-4,9,14,16H,2,5-8H2,1H3 |
| InChIKey | GMODLYGNOBZQKE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|