C18H29FO3S — CID 59546163
4-(7-tert-butylsulfonylheptyl)-2-fluoro-1-methoxybenzene (PubChem CID 59546163) has the molecular formula C18H29FO3S and a molecular weight of 344.49 g/mol. Its IUPAC name is 4-(7-tert-butylsulfonylheptyl)-2-fluoro-1-methoxybenzene.
| Compound Name | 4-(7-tert-butylsulfonylheptyl)-2-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 59546163 |
| Molecular Formula | C18H29FO3S |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-(7-tert-butylsulfonylheptyl)-2-fluoro-1-methoxybenzene |
| SMILES | COc1ccc(CCCCCCCS(=O)(=O)C(C)(C)C)cc1F |
| InChI | InChI=1S/C18H29FO3S/c1-18(2,3)23(20,21)13-9-7-5-6-8-10-15-11-12-17(22-4)16(19)14-15/h11-12,14H,5-10,13H2,1-4H3 |
| InChIKey | GWSXVNBXXISEMY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|