C19H29F3O2S — CID 159594806
4-(7-tert-butylsulfonylheptyl)-2-methyl-1-(trifluoromethyl)benzene (PubChem CID 159594806) has the molecular formula C19H29F3O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-(7-tert-butylsulfonylheptyl)-2-methyl-1-(trifluoromethyl)benzene.
| Compound Name | 4-(7-tert-butylsulfonylheptyl)-2-methyl-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 159594806 |
| Molecular Formula | C19H29F3O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-(7-tert-butylsulfonylheptyl)-2-methyl-1-(trifluoromethyl)benzene |
| SMILES | Cc1cc(CCCCCCCS(=O)(=O)C(C)(C)C)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H29F3O2S/c1-15-14-16(11-12-17(15)19(20,21)22)10-8-6-5-7-9-13-25(23,24)18(2,3)4/h11-12,14H,5-10,13H2,1-4H3 |
| InChIKey | YXUWZXZAYBMQHH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|