C19H30O5S — CID 158703910
2-[3-(7-tert-butylsulfonylheptyl)phenoxy]acetic acid (PubChem CID 158703910) has the molecular formula C19H30O5S and a molecular weight of 370.51 g/mol. Its IUPAC name is 2-[3-(7-tert-butylsulfonylheptyl)phenoxy]acetic acid.
| Compound Name | 2-[3-(7-tert-butylsulfonylheptyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 158703910 |
| Molecular Formula | C19H30O5S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[3-(7-tert-butylsulfonylheptyl)phenoxy]acetic acid |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCCCc1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C19H30O5S/c1-19(2,3)25(22,23)13-8-6-4-5-7-10-16-11-9-12-17(14-16)24-15-18(20)21/h9,11-12,14H,4-8,10,13,15H2,1-3H3,(H,20,21) |
| InChIKey | RXICACJOKWSKQG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|