C17H27ClO2S — CID 159161335
1-(7-tert-butylsulfonylheptyl)-3-chlorobenzene (PubChem CID 159161335) has the molecular formula C17H27ClO2S and a molecular weight of 330.92 g/mol. Its IUPAC name is 1-(7-tert-butylsulfonylheptyl)-3-chlorobenzene.
| Compound Name | 1-(7-tert-butylsulfonylheptyl)-3-chlorobenzene |
|---|---|
| PubChem CID | 159161335 |
| Molecular Formula | C17H27ClO2S |
| Molecular Weight | 330.92 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-(7-tert-butylsulfonylheptyl)-3-chlorobenzene |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H27ClO2S/c1-17(2,3)21(19,20)13-8-6-4-5-7-10-15-11-9-12-16(18)14-15/h9,11-12,14H,4-8,10,13H2,1-3H3 |
| InChIKey | ZPYCMEQREFHVTK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.92 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|