C15H23ClO3S — CID 106734378
4-tert-butylsulfonyl-2-[(3-chlorophenyl)methyl]butan-1-ol (PubChem CID 106734378) has the molecular formula C15H23ClO3S and a molecular weight of 318.87 g/mol. Its IUPAC name is 4-tert-butylsulfonyl-2-[(3-chlorophenyl)methyl]butan-1-ol.
| Compound Name | 4-tert-butylsulfonyl-2-[(3-chlorophenyl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 106734378 |
| Molecular Formula | C15H23ClO3S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-tert-butylsulfonyl-2-[(3-chlorophenyl)methyl]butan-1-ol |
| SMILES | CC(C)(C)S(=O)(=O)CCC(CO)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClO3S/c1-15(2,3)20(18,19)8-7-13(11-17)9-12-5-4-6-14(16)10-12/h4-6,10,13,17H,7-9,11H2,1-3H3 |
| InChIKey | XLYXTPBJGDGGLJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |