C16H26BrNO2S — CID 106729740
2-[(3-bromophenyl)methyl]-4-tert-butylsulfonyl-N-methylbutan-1-amine (PubChem CID 106729740) has the molecular formula C16H26BrNO2S and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-4-tert-butylsulfonyl-N-methylbutan-1-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-4-tert-butylsulfonyl-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 106729740 |
| Molecular Formula | C16H26BrNO2S |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-4-tert-butylsulfonyl-N-methylbutan-1-amine |
| SMILES | CNCC(CCS(=O)(=O)C(C)(C)C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H26BrNO2S/c1-16(2,3)21(19,20)9-8-14(12-18-4)10-13-6-5-7-15(17)11-13/h5-7,11,14,18H,8-10,12H2,1-4H3 |
| InChIKey | WITLVFBWPDVJBZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |