C13H19ClO2 — CID 172914223
(2S)-2-[(3-chlorophenyl)methyl]hexane-1,6-diol (PubChem CID 172914223) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is (2S)-2-[(3-chlorophenyl)methyl]hexane-1,6-diol.
| Compound Name | (2S)-2-[(3-chlorophenyl)methyl]hexane-1,6-diol |
|---|---|
| PubChem CID | 172914223 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (2S)-2-[(3-chlorophenyl)methyl]hexane-1,6-diol |
| SMILES | OCCCC[C@H](CO)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19ClO2/c14-13-6-3-5-11(9-13)8-12(10-16)4-1-2-7-15/h3,5-6,9,12,15-16H,1-2,4,7-8,10H2/t12-/m0/s1 |
| InChIKey | DFRNJJVFUWAVTB-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|