C13H19FO2 — CID 172914267
(2S)-2-[(4-fluorophenyl)methyl]hexane-1,6-diol (PubChem CID 172914267) has the molecular formula C13H19FO2 and a molecular weight of 226.29 g/mol. Its IUPAC name is (2S)-2-[(4-fluorophenyl)methyl]hexane-1,6-diol.
| Compound Name | (2S)-2-[(4-fluorophenyl)methyl]hexane-1,6-diol |
|---|---|
| PubChem CID | 172914267 |
| Molecular Formula | C13H19FO2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (2S)-2-[(4-fluorophenyl)methyl]hexane-1,6-diol |
| SMILES | OCCCC[C@H](CO)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FO2/c14-13-6-4-11(5-7-13)9-12(10-16)3-1-2-8-15/h4-7,12,15-16H,1-3,8-10H2/t12-/m0/s1 |
| InChIKey | VEZLTYKWAHOVTF-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|