C13H18F2O2 — CID 172914226
(2S)-2-[(3,4-difluorophenyl)methyl]hexane-1,6-diol (PubChem CID 172914226) has the molecular formula C13H18F2O2 and a molecular weight of 244.28 g/mol. Its IUPAC name is (2S)-2-[(3,4-difluorophenyl)methyl]hexane-1,6-diol.
| Compound Name | (2S)-2-[(3,4-difluorophenyl)methyl]hexane-1,6-diol |
|---|---|
| PubChem CID | 172914226 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (2S)-2-[(3,4-difluorophenyl)methyl]hexane-1,6-diol |
| SMILES | OCCCC[C@H](CO)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2O2/c14-12-5-4-10(8-13(12)15)7-11(9-17)3-1-2-6-16/h4-5,8,11,16-17H,1-3,6-7,9H2/t11-/m0/s1 |
| InChIKey | XXYZABGKNVJBQU-NSHDSACASA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|