C7H6F2O — CID 522833
(3,4-difluorophenyl)methanol (PubChem CID 522833) has the molecular formula C7H6F2O and a molecular weight of 144.12 g/mol. Its IUPAC name is (3,4-difluorophenyl)methanol.
| Compound Name | (3,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 522833 |
| Molecular Formula | C7H6F2O |
| Molecular Weight | 144.12 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3,4-difluorophenyl)methanol |
| SMILES | OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C7H6F2O/c8-6-2-1-5(4-10)3-7(6)9/h1-3,10H,4H2 |
| InChIKey | GNQLTCVBSGVGHC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.12 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |