C8H10ClF2N — CID 66523804
2-(3,4-difluorophenyl)ethanamine;hydrochloride (PubChem CID 66523804) has the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)ethanamine;hydrochloride.
| Compound Name | 2-(3,4-difluorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 66523804 |
| Molecular Formula | C8H10ClF2N |
| Molecular Weight | 193.62 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-(3,4-difluorophenyl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H9F2N.ClH/c9-7-2-1-6(3-4-11)5-8(7)10;/h1-2,5H,3-4,11H2;1H |
| InChIKey | UTNHFYIEDYWAMO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |