C14H13F2NO — CID 82296847
4-(2-aminoethyl)-2-(3,4-difluorophenyl)phenol (PubChem CID 82296847) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-(3,4-difluorophenyl)phenol.
| Compound Name | 4-(2-aminoethyl)-2-(3,4-difluorophenyl)phenol |
|---|---|
| PubChem CID | 82296847 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-(2-aminoethyl)-2-(3,4-difluorophenyl)phenol |
| SMILES | NCCc1ccc(O)c(-c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C14H13F2NO/c15-12-3-2-10(8-13(12)16)11-7-9(5-6-17)1-4-14(11)18/h1-4,7-8,18H,5-6,17H2 |
| InChIKey | HNEUJEOCBRXROP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |