C8H13NO2Sr — CID 174942711
strontium;4-(2-aminoethyl)benzene-1,2-diol;hydride (PubChem CID 174942711) has the molecular formula C8H13NO2Sr and a molecular weight of 242.82 g/mol. Its IUPAC name is strontium;4-(2-aminoethyl)benzene-1,2-diol;hydride.
| Compound Name | strontium;4-(2-aminoethyl)benzene-1,2-diol;hydride |
|---|---|
| PubChem CID | 174942711 |
| Molecular Formula | C8H13NO2Sr |
| Molecular Weight | 242.82 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | strontium;4-(2-aminoethyl)benzene-1,2-diol;hydride |
| SMILES | NCCc1ccc(O)c(O)c1.[H-].[H-].[Sr+2] |
| InChI | InChI=1S/C8H11NO2.Sr.2H/c9-4-3-6-1-2-7(10)8(11)5-6;;;/h1-2,5,10-11H,3-4,9H2;;;/q;+2;2*-1 |
| InChIKey | LJWUGVSVEMSCAS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.82 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|