C13H25N2O3+ — CID 174847471
4-(2-aminoethyl)benzene-1,2-diol;2-hydroxyethyl(trimethyl)azanium (PubChem CID 174847471) has the molecular formula C13H25N2O3+ and a molecular weight of 257.35 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 174847471 |
| Molecular Formula | C13H25N2O3+ |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2.C5H14NO/c9-4-3-6-1-2-7(10)8(11)5-6;1-6(2,3)4-5-7/h1-2,5,10-11H,3-4,9H2;7H,4-5H2,1-3H3/q;+1 |
| InChIKey | FCYUMFVVKYZNLH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|