C10H19NO2 — CID 175755753
4-(2-aminoethyl)benzene-1,2-diol;methane (PubChem CID 175755753) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;methane.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;methane |
|---|---|
| PubChem CID | 175755753 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;methane |
| SMILES | C.C.NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2.2CH4/c9-4-3-6-1-2-7(10)8(11)5-6;;/h1-2,5,10-11H,3-4,9H2;2*1H4 |
| InChIKey | IZPIJCPYJNXEIJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|