C19H24N2O5 — CID 175123795
4-(2-aminoethyl)benzene-1,2-diol;N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide (PubChem CID 175123795) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-(2-aminoethyl)benzene-1,2-diol;N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide.
| Compound Name | 4-(2-aminoethyl)benzene-1,2-diol;N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 175123795 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-(2-aminoethyl)benzene-1,2-diol;N-[2-(3,4-dihydroxyphenyl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1ccc(O)c(O)c1.NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H13NO3.C8H11NO2/c1-2-11(15)12-6-5-8-3-4-9(13)10(14)7-8;9-4-3-6-1-2-7(10)8(11)5-6/h2-4,7,13-14H,1,5-6H2,(H,12,15);1-2,5,10-11H,3-4,9H2 |
| InChIKey | XHUXKPFKCTYHKB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|